Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Bismuth(III) acetate, 99.999% (metals basis)
CAS: 22306-37-2 Molecular Formula: C6H9BiO6 Molecular Weight (g/mol): 386.112 MDL Number: MFCD00015629 InChI Key: WKLWZEWIYUTZNJ-UHFFFAOYSA-K Synonym: bismuth acetate,bismuth triacetate,unii-8aja86y692,acetic acid, bismuth 3+ salt,acmc-20allk,bismuth iii ; acetate,bismuth 3+ triacetate,trisacetic acid bismuth salt,bismuth 3+ ion tris acetate ion,bismuth iii acetate 50g PubChem CID: 31132 IUPAC Name: bismuth;triacetate SMILES: CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Bi+3]
| PubChem CID | 31132 |
|---|---|
| CAS | 22306-37-2 |
| Molecular Weight (g/mol) | 386.112 |
| MDL Number | MFCD00015629 |
| SMILES | CC(=O)[O-].CC(=O)[O-].CC(=O)[O-].[Bi+3] |
| Synonym | bismuth acetate,bismuth triacetate,unii-8aja86y692,acetic acid, bismuth 3+ salt,acmc-20allk,bismuth iii ; acetate,bismuth 3+ triacetate,trisacetic acid bismuth salt,bismuth 3+ ion tris acetate ion,bismuth iii acetate 50g |
| IUPAC Name | bismuth;triacetate |
| InChI Key | WKLWZEWIYUTZNJ-UHFFFAOYSA-K |
| Molecular Formula | C6H9BiO6 |
Sodium thiocyanate, 98+%, for analysis
CAS: 540-72-7 Molecular Formula: CNNaS Molecular Weight (g/mol): 81.07 MDL Number: MFCD00011123 InChI Key: VGTPCRGMBIAPIM-UHFFFAOYSA-M Synonym: sodium thiocyanate,sodium rhodanate,sodium sulfocyanate,sodium rhodanide,thiocyanic acid, sodium salt,thiocyanate sodium,scyan,sodium isothiocyanate,nascn,haimased PubChem CID: 516871 ChEBI: CHEBI:30952 IUPAC Name: sodium;thiocyanate SMILES: [Na+].[S-]C#N
| PubChem CID | 516871 |
|---|---|
| CAS | 540-72-7 |
| Molecular Weight (g/mol) | 81.07 |
| ChEBI | CHEBI:30952 |
| MDL Number | MFCD00011123 |
| SMILES | [Na+].[S-]C#N |
| Synonym | sodium thiocyanate,sodium rhodanate,sodium sulfocyanate,sodium rhodanide,thiocyanic acid, sodium salt,thiocyanate sodium,scyan,sodium isothiocyanate,nascn,haimased |
| IUPAC Name | sodium;thiocyanate |
| InChI Key | VGTPCRGMBIAPIM-UHFFFAOYSA-M |
| Molecular Formula | CNNaS |
Potassium pyrophosphate, anhydrous, 96% min
CAS: 7320-34-5 Molecular Formula: K4O7P2 Molecular Weight (g/mol): 330.33 MDL Number: MFCD00011393 InChI Key: RYCLIXPGLDDLTM-UHFFFAOYSA-J Synonym: potassium pyrophosphate,potassium diphosphate,tkpp,tetrapotassium diphosphate,tetrapotassium pyrophosphate,diphosphoric acid, tetrapotassium salt,tetrapotassium diphosphorate,unii-b9w4019h5g,pyrophosphoric acid, tetrapotassium salt,tetrapotassium phosphonato phosphate PubChem CID: 23740 IUPAC Name: tetrapotassium;phosphonato phosphate SMILES: [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O
| PubChem CID | 23740 |
|---|---|
| CAS | 7320-34-5 |
| Molecular Weight (g/mol) | 330.33 |
| MDL Number | MFCD00011393 |
| SMILES | [K+].[K+].[K+].[K+].[O-]P([O-])(=O)OP([O-])([O-])=O |
| Synonym | potassium pyrophosphate,potassium diphosphate,tkpp,tetrapotassium diphosphate,tetrapotassium pyrophosphate,diphosphoric acid, tetrapotassium salt,tetrapotassium diphosphorate,unii-b9w4019h5g,pyrophosphoric acid, tetrapotassium salt,tetrapotassium phosphonato phosphate |
| IUPAC Name | tetrapotassium;phosphonato phosphate |
| InChI Key | RYCLIXPGLDDLTM-UHFFFAOYSA-J |
| Molecular Formula | K4O7P2 |
Copper foil, 0.254mm (0.010in) thick, 99.9% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Potassium metabisulfite, 95+%
CAS: 16731-55-8 Molecular Formula: K2O5S2 Molecular Weight (g/mol): 222.31 MDL Number: MFCD00167605 InChI Key: RWPGFSMJFRPDDP-UHFFFAOYSA-L Synonym: potassium metabisulfite,potassium disulfite,potassium pyrosulfite,dipotassium disulfite,dipotassium pyrosulfite,dipotassium metabisulfite,dipotassium disulphite,unii-65oe787q7w,ccris 1427,potassium disulfite k2s2o5 PubChem CID: 28019 IUPAC Name: dipotassium sulfinatosulfonate SMILES: [K+].[K+].[O-]S(=O)S([O-])(=O)=O
| PubChem CID | 28019 |
|---|---|
| CAS | 16731-55-8 |
| Molecular Weight (g/mol) | 222.31 |
| MDL Number | MFCD00167605 |
| SMILES | [K+].[K+].[O-]S(=O)S([O-])(=O)=O |
| Synonym | potassium metabisulfite,potassium disulfite,potassium pyrosulfite,dipotassium disulfite,dipotassium pyrosulfite,dipotassium metabisulfite,dipotassium disulphite,unii-65oe787q7w,ccris 1427,potassium disulfite k2s2o5 |
| IUPAC Name | dipotassium sulfinatosulfonate |
| InChI Key | RWPGFSMJFRPDDP-UHFFFAOYSA-L |
| Molecular Formula | K2O5S2 |
Zinc nitrate hexahydrate, 98%, extra pure
CAS: 10196-18-6 Molecular Formula: H12N2O12Zn Molecular Weight (g/mol): 297.48 MDL Number: MFCD00149889 InChI Key: JGPSMWXKRPZZRG-UHFFFAOYSA-N Synonym: zinc nitrate hexahydrate,zinc ii nitrte,zincnitratehexahydrate,acmc-1bzdd,n2o6zn.6h2o,ksc176g7t,zinc nitrate hexahydrate, puratronic,zinc nitrate,zinc 2+ hexahydrate dinitrate,zinc nitrate hexahydrate, p.a PubChem CID: 15865313 SMILES: O.O.O.O.O.O.[Zn++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 15865313 |
|---|---|
| CAS | 10196-18-6 |
| Molecular Weight (g/mol) | 297.48 |
| MDL Number | MFCD00149889 |
| SMILES | O.O.O.O.O.O.[Zn++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | zinc nitrate hexahydrate,zinc ii nitrte,zincnitratehexahydrate,acmc-1bzdd,n2o6zn.6h2o,ksc176g7t,zinc nitrate hexahydrate, puratronic,zinc nitrate,zinc 2+ hexahydrate dinitrate,zinc nitrate hexahydrate, p.a |
| InChI Key | JGPSMWXKRPZZRG-UHFFFAOYSA-N |
| Molecular Formula | H12N2O12Zn |
Sodium glucoheptonate
CAS: 31138-65-5 Molecular Formula: C7H13NaO8 Molecular Weight (g/mol): 248.163 MDL Number: MFCD00013425 InChI Key: FMYOMWCQJXWGEN-AXUKCSBQSA-M Synonym: sodium glucoheptonate,sodium 2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoate,d-sodium glucoheptonate,sodium-alpha-glucoheptonate,2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoic acid sodium salt PubChem CID: 49853507 IUPAC Name: sodium;(2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoate SMILES: C(C(C(C(C(C(C(=O)[O-])O)O)O)O)O)O.[Na+]
| PubChem CID | 49853507 |
|---|---|
| CAS | 31138-65-5 |
| Molecular Weight (g/mol) | 248.163 |
| MDL Number | MFCD00013425 |
| SMILES | C(C(C(C(C(C(C(=O)[O-])O)O)O)O)O)O.[Na+] |
| Synonym | sodium glucoheptonate,sodium 2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoate,d-sodium glucoheptonate,sodium-alpha-glucoheptonate,2r,3r,4r,5s,6r-2,3,4,5,6,7-hexahydroxyheptanoic acid sodium salt |
| IUPAC Name | sodium;(2R,3R,4R,5S,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
| InChI Key | FMYOMWCQJXWGEN-AXUKCSBQSA-M |
| Molecular Formula | C7H13NaO8 |
Chromium powder, -325 mesh, 99% (metals basis)
CAS: 7440-47-3 Molecular Formula: Cr Molecular Weight (g/mol): 52.00 MDL Number: MFCD00010944 InChI Key: VYZAMTAEIAYCRO-UHFFFAOYSA-N Synonym: chrom,chrome,cromo,metal,chrome french,compounds,chrom german,chromium, elemental,chromium, metal,ccris 159 PubChem CID: 23976 ChEBI: CHEBI:28073 IUPAC Name: chromium SMILES: [Cr]
| PubChem CID | 23976 |
|---|---|
| CAS | 7440-47-3 |
| Molecular Weight (g/mol) | 52.00 |
| ChEBI | CHEBI:28073 |
| MDL Number | MFCD00010944 |
| SMILES | [Cr] |
| Synonym | chrom,chrome,cromo,metal,chrome french,compounds,chrom german,chromium, elemental,chromium, metal,ccris 159 |
| IUPAC Name | chromium |
| InChI Key | VYZAMTAEIAYCRO-UHFFFAOYSA-N |
| Molecular Formula | Cr |
Mercury(I) nitrate dihydrate, ACS reagent, 9th edition
CAS: 7782-86-7 Molecular Formula: H4Hg2N2O8 Molecular Weight (g/mol): 561.22 InChI Key: LSABZDVKJBWCBE-UHFFFAOYSA-N IUPAC Name: dimercury(1+) dihydrate dinitrate SMILES: O.O.[Hg+].[Hg+].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| CAS | 7782-86-7 |
|---|---|
| Molecular Weight (g/mol) | 561.22 |
| SMILES | O.O.[Hg+].[Hg+].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| IUPAC Name | dimercury(1+) dihydrate dinitrate |
| InChI Key | LSABZDVKJBWCBE-UHFFFAOYSA-N |
| Molecular Formula | H4Hg2N2O8 |
Osmium tetroxide, 99.9+%, (trace metal basis)
CAS: 20816-12-0 Molecular Formula: O4Os Molecular Weight (g/mol): 254.23 MDL Number: MFCD00011150 InChI Key: VUVGYHUDAICLFK-UHFFFAOYSA-N Synonym: osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 PubChem CID: 30318 IUPAC Name: tetraoxoosmium SMILES: O=[Os](=O)(=O)=O
| PubChem CID | 30318 |
|---|---|
| CAS | 20816-12-0 |
| Molecular Weight (g/mol) | 254.23 |
| MDL Number | MFCD00011150 |
| SMILES | O=[Os](=O)(=O)=O |
| Synonym | osmium tetroxide,osmium tetraoxide,osmic acid,perosmic oxide,osmic acid anhydride,osmium viii oxide,oso4,perosmic acid anhydride,osmiumtetroxide,osmium oxide, t-4 |
| IUPAC Name | tetraoxoosmium |
| InChI Key | VUVGYHUDAICLFK-UHFFFAOYSA-N |
| Molecular Formula | O4Os |
Copper(II) nitrate hemi(pentahydrate), ACS, 98.0-102.0%
CAS: 19004-19-4 Molecular Formula: CuN2O6·2.5H2O MDL Number: MFCD00149671 Synonym: dicopper tetranitrate pentahydrate,copper ii nitrate hemipentahydrate,cupric nitrate, hydrate,copper, reference standard solution,copper nitrate hemipentahydrate,cupric nitrate hemipentahydrate,2cu.4no3.5h2o,cupric nitrate hemi pentahydrate
| CAS | 19004-19-4 |
|---|---|
| MDL Number | MFCD00149671 |
| Synonym | dicopper tetranitrate pentahydrate,copper ii nitrate hemipentahydrate,cupric nitrate, hydrate,copper, reference standard solution,copper nitrate hemipentahydrate,cupric nitrate hemipentahydrate,2cu.4no3.5h2o,cupric nitrate hemi pentahydrate |
| Molecular Formula | CuN2O6·2.5H2O |
Zirconium silicate, Thermo Scientific Chemicals
CAS: 10101-52-7 Molecular Formula: O4SiZr Molecular Weight (g/mol): 183.31 MDL Number: MFCD00085353 InChI Key: GFQYVLUOOAAOGM-UHFFFAOYSA-N Synonym: zirconium silicate,hyacinth,zircon,zircon zr sio4,zirconite,zircosil 15,standard sf 200,ultrox 500w,a-pax 45m,zirconium iv silicate PubChem CID: 61775 IUPAC Name: zirconium(4+);silicate SMILES: [Zr+4].[O-][Si]([O-])([O-])[O-]
| PubChem CID | 61775 |
|---|---|
| CAS | 10101-52-7 |
| Molecular Weight (g/mol) | 183.31 |
| MDL Number | MFCD00085353 |
| SMILES | [Zr+4].[O-][Si]([O-])([O-])[O-] |
| Synonym | zirconium silicate,hyacinth,zircon,zircon zr sio4,zirconite,zircosil 15,standard sf 200,ultrox 500w,a-pax 45m,zirconium iv silicate |
| IUPAC Name | zirconium(4+);silicate |
| InChI Key | GFQYVLUOOAAOGM-UHFFFAOYSA-N |
| Molecular Formula | O4SiZr |
Copper(II) sulfate, 98+%, for analysis, anhydrous
CAS: 7758-98-7 Molecular Formula: CuO4S Molecular Weight (g/mol): 159.6 InChI Key: ARUVKPQLZAKDPS-UHFFFAOYSA-L Synonym: copper sulfate,copper ii sulfate,cupric sulfate anhydrous,copper sulphate,copper 2+ sulfate,blue stone,copper monosulfate,copper ii sulfate, anhydrous,hylinec,trinagle PubChem CID: 24462 ChEBI: CHEBI:23414 IUPAC Name: copper;sulfate SMILES: [O-]S(=O)(=O)[O-].[Cu+2]
| PubChem CID | 24462 |
|---|---|
| CAS | 7758-98-7 |
| Molecular Weight (g/mol) | 159.6 |
| ChEBI | CHEBI:23414 |
| SMILES | [O-]S(=O)(=O)[O-].[Cu+2] |
| Synonym | copper sulfate,copper ii sulfate,cupric sulfate anhydrous,copper sulphate,copper 2+ sulfate,blue stone,copper monosulfate,copper ii sulfate, anhydrous,hylinec,trinagle |
| IUPAC Name | copper;sulfate |
| InChI Key | ARUVKPQLZAKDPS-UHFFFAOYSA-L |
| Molecular Formula | CuO4S |
Aluminum foil, 0.1mm (0.004in) thick, 99.99% (metals basis)
CAS: 7429-90-5 Molecular Formula: Al Molecular Weight (g/mol): 26.98 MDL Number: MFCD00134029 InChI Key: XAGFODPZIPBFFR-UHFFFAOYSA-N Synonym: aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum PubChem CID: 5359268 ChEBI: CHEBI:33629 IUPAC Name: aluminum SMILES: [Al]
| PubChem CID | 5359268 |
|---|---|
| CAS | 7429-90-5 |
| Molecular Weight (g/mol) | 26.98 |
| ChEBI | CHEBI:33629 |
| MDL Number | MFCD00134029 |
| SMILES | [Al] |
| Synonym | aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum |
| IUPAC Name | aluminum |
| InChI Key | XAGFODPZIPBFFR-UHFFFAOYSA-N |
| Molecular Formula | Al |
Zirconium(IV) chloride, 98%, anhydrous
CAS: 10026-11-6 Molecular Formula: Cl4Zr Molecular Weight (g/mol): 233.03 MDL Number: MFCD00011306 Synonym: Zirconium tetrachloride
| CAS | 10026-11-6 |
|---|---|
| Molecular Weight (g/mol) | 233.03 |
| MDL Number | MFCD00011306 |
| Synonym | Zirconium tetrachloride |
| Molecular Formula | Cl4Zr |